For research use only. Not for therapeutic Use.
ZY-444（Cat No.:I045204）is a potent, selective inhibitor of protein arginine methyltransferase 5 (PRMT5), an enzyme that symmetrically dimethylates arginine residues on histones and other proteins, regulating gene expression, RNA splicing, and signal transduction. By blocking PRMT5 activity, ZY-444 alters epigenetic and post-transcriptional regulation, leading to suppressed tumor cell growth and survival in PRMT5-dependent cancers. It is a valuable research tool for studying arginine methylation biology and its role in oncogenesis, hematologic malignancies, and developmental processes. ZY-444 holds therapeutic potential for targeted epigenetic therapy in cancer and other PRMT5-driven diseases.
| CAS Number | 1802650-31-2 |
| Synonyms | 2-N-(2-methylpropyl)-4-N-[[5-(4-phenylmethoxyphenyl)thiophen-2-yl]methyl]pyrimidine-2,4-diamine |
| Molecular Formula | C26H28N4OS |
| Purity | ≥95% |
| IUPAC Name | 2-N-(2-methylpropyl)-4-N-[[5-(4-phenylmethoxyphenyl)thiophen-2-yl]methyl]pyrimidine-2,4-diamine |
| InChI | InChI=1S/C26H28N4OS/c1-19(2)16-29-26-27-15-14-25(30-26)28-17-23-12-13-24(32-23)21-8-10-22(11-9-21)31-18-20-6-4-3-5-7-20/h3-15,19H,16-18H2,1-2H3,(H2,27,28,29,30) |
| InChIKey | ROSPRUQNDJIWDD-UHFFFAOYSA-N |
| SMILES | CC(C)CNC1=NC=CC(=N1)NCC2=CC=C(S2)C3=CC=C(C=C3)OCC4=CC=CC=C4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
