For research use only. Not for therapeutic Use.
ZT-1a（Cat No.:I015178）is a selective small-molecule inhibitor of casein kinase 2 (CK2), a serine/threonine kinase implicated in numerous cellular processes, including cell survival, proliferation, and stress response. By targeting CK2 activity, ZT-1a disrupts oncogenic signaling pathways such as PI3K/Akt and NF-κB, making it a promising tool for cancer research. Beyond oncology, CK2 inhibition is also studied in inflammation, neurodegeneration, and viral infection models. ZT-1a’s potency and selectivity highlight its value as a chemical probe for dissecting CK2-mediated mechanisms in biomedical research.
| CAS Number | 212135-62-1 |
| Synonyms | 5-chloro-N-[5-chloro-4-[(4-chlorophenyl)-cyanomethyl]-2-methylphenyl]-2-hydroxybenzamide |
| Molecular Formula | C22H15Cl3N2O2 |
| Purity | ≥95% |
| IUPAC Name | 5-chloro-N-[5-chloro-4-[(4-chlorophenyl)-cyanomethyl]-2-methylphenyl]-2-hydroxybenzamide |
| InChI | InChI=1S/C22H15Cl3N2O2/c1-12-8-16(18(11-26)13-2-4-14(23)5-3-13)19(25)10-20(12)27-22(29)17-9-15(24)6-7-21(17)28/h2-10,18,28H,1H3,(H,27,29) |
| InChIKey | RPTKRVXJNWPJLU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1NC(=O)C2=C(C=CC(=C2)Cl)O)Cl)C(C#N)C3=CC=C(C=C3)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
