For research use only. Not for therapeutic Use.
Ziyuglycoside II(Cat No.:R010715) is a triterpenoid saponin compound extracted from Sanguisorba officinalis L. It exhibits various biological activities, including inducing reactive oxygen species (ROS) generation and apoptosis (cell death). Ziyuglycoside II has demonstrated anti-inflammatory effects and has been found to possess anti-cancer properties. The compound shows promising potential for further research and development as a natural therapeutic agent for inflammatory and cancer-related conditions.
| CAS Number | 35286-59-0 |
| Molecular Formula | C35H56O8 |
| Purity | ≥95% |
| Target | NF-κB |
| Storage | -20°C, protect from light |
| IUPAC Name | (1R,2R,4aS,6aR,6aS,6bR,8aR,10S,12aR,14bS)-1-hydroxy-1,2,6a,6b,9,9,12a-heptamethyl-10-[(2S,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxy-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid |
| InChI | InChI=1S/C35H56O8/c1-19-10-15-35(29(39)40)17-16-32(5)20(27(35)34(19,7)41)8-9-23-31(4)13-12-24(30(2,3)22(31)11-14-33(23,32)6)43-28-26(38)25(37)21(36)18-42-28/h8,19,21-28,36-38,41H,9-18H2,1-7H3,(H,39,40)/t19-,21+,22+,23-,24+,25+,26-,27-,28+,31+,32-,33-,34-,35+/m1/s1 |
| InChIKey | MFIXLWYJTVEVGO-YHGWSDCJSA-N |
| SMILES | CC1CCC2(CCC3(C(=CCC4C3(CCC5C4(CCC(C5(C)C)OC6C(C(C(CO6)O)O)O)C)C)C2C1(C)O)C)C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |