For research use only. Not for therapeutic Use.
ZINC12613047 (Cat No.: I011549) is a small-molecule compound listed in the ZINC database, commonly used for virtual screening and drug discovery research. It has been studied as a potential inhibitor of protein-protein interactions or enzyme activity, depending on the target of interest in specific studies. As part of the ZINC chemical library, ZINC12613047 is valued for its drug-like properties, including favorable solubility and binding potential. Researchers utilize it in computational docking, structure-activity relationship (SAR) studies, and early-stage development of therapeutic candidates.
| CAS Number | 1069521-64-7 |
| Synonyms | N-[[1-(2,3-dihydro-1H-inden-2-yl)-3-piperidinyl]methyl]-N-(2-methoxyethyl)-2-naphthalenecarboxamide |
| Molecular Formula | C29H34N2O2 |
| Purity | ≥95% |
| Target | Cholinesterases |
| Solubility | Soluble in DMSO |
| Storage | Store at -20°C |
| IUPAC Name | N-[[1-(2,3-dihydro-1H-inden-2-yl)piperidin-3-yl]methyl]-N-(2-methoxyethyl)naphthalene-2-carboxamide |
| InChI | 1S/C29H34N2O2/c1-33-16-15-31(29(32)27-13-12-23-8-2-3-9-24(23)17-27)21-22-7-6-14-30(20-22)28-18-25-10-4-5-11-26(25)19-28/h2-5,8-13,17,22,28H,6-7,14-16,18-21H2,1H3 |
| InChIKey | NRBCHFHGWACYAH-UHFFFAOYSA-N |
| SMILES | COCCN(CC1CCCN(C1)C2CC3=CC=CC=C3C2)C(=O)C4=CC5=CC=CC=C5C=C4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
