For research use only. Not for therapeutic Use.
Zectivimod（Cat No.:I038674）is an investigational immunomodulatory agent designed to modulate innate immune responses by targeting Toll-like receptor (TLR) signaling pathways. It primarily acts to reduce chronic inflammation associated with autoimmune and inflammatory diseases such as rheumatoid arthritis and lupus. Zectivimod suppresses pro-inflammatory cytokine production, helping to restore immune balance without broadly suppressing the immune system. Preclinical studies suggest favorable pharmacodynamics and a strong safety profile, making it a promising candidate for targeted immunotherapy. Its mechanism supports selective immune regulation, offering potential benefits over traditional anti-inflammatory treatments.
| CAS Number | 1623066-63-6 |
| Synonyms | 1-[[1-chloro-6-[(3-chloro-1-propan-2-ylindazol-5-yl)methoxy]-3,4-dihydronaphthalen-2-yl]methyl]piperidine-4-carboxylic acid |
| Molecular Formula | C28H31Cl2N3O3 |
| Purity | ≥95% |
| IUPAC Name | 1-[[1-chloro-6-[(3-chloro-1-propan-2-ylindazol-5-yl)methoxy]-3,4-dihydronaphthalen-2-yl]methyl]piperidine-4-carboxylic acid |
| InChI | InChI=1S/C28H31Cl2N3O3/c1-17(2)33-25-8-3-18(13-24(25)27(30)31-33)16-36-22-6-7-23-20(14-22)4-5-21(26(23)29)15-32-11-9-19(10-12-32)28(34)35/h3,6-8,13-14,17,19H,4-5,9-12,15-16H2,1-2H3,(H,34,35) |
| InChIKey | XKKXISSRVOVRGI-UHFFFAOYSA-N |
| SMILES | CC(C)N1C2=C(C=C(C=C2)COC3=CC4=C(C=C3)C(=C(CC4)CN5CCC(CC5)C(=O)O)Cl)C(=N1)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
