For research use only. Not for therapeutic Use.
ZAPA sulfate(Cat No.:I005545)is a synthetic compound primarily used in pharmaceutical research as a potential therapeutic agent. It acts as an inhibitor, targeting specific biological pathways involved in disease processes. This compound has shown promise in various research areas, particularly in inflammation and immunology. Its mechanism involves modulating enzyme activity and receptor binding to influence cellular responses. Ongoing studies aim to better understand its effectiveness and safety profile, especially in treating conditions related to inflammation, autoimmune diseases, and other immune-related disorders. Further development and clinical trials are required to confirm its therapeutic potential.
| CAS Number | 371962-01-5 |
| Synonyms | (Z)-3-carbamimidoylsulfanylprop-2-enoic acid;sulfuric acid |
| Molecular Formula | C4H8N2O6S2 |
| Purity | ≥95% |
| IUPAC Name | (Z)-3-carbamimidoylsulfanylprop-2-enoic acid;sulfuric acid |
| InChI | InChI=1S/C4H6N2O2S.H2O4S/c5-4(6)9-2-1-3(7)8;1-5(2,3)4/h1-2H,(H3,5,6)(H,7,8);(H2,1,2,3,4)/b2-1-; |
| InChIKey | UWVNHPNVOMFDHW-ODZAUARKSA-N |
| SMILES | C(=C\SC(=N)N)\C(=O)O.OS(=O)(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |