For research use only. Not for therapeutic Use.
Z62954982（Cat No.:I012103）is a synthetic small-molecule compound cataloged in chemical screening libraries and investigated as a potential pharmacological tool. Preliminary studies suggest its relevance in modulating signaling pathways involved in cancer biology, neurodegeneration, and metabolic disorders. With a defined chemical scaffold, Z62954982 enables researchers to probe target engagement, assess structure–activity relationships, and explore therapeutic leads. Its utility lies in high-throughput screening and mechanistic investigations, where it helps identify novel biological interactions. As a research compound, Z62954982 supports drug discovery programs across oncology, neurology, and metabolic disease fields.
| CAS Number | 1090893-12-1 |
| Synonyms | 3-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-N-(4-methyl-3-sulfamoylphenyl)benzamide |
| Molecular Formula | C20H21N3O5S |
| Purity | ≥95% |
| IUPAC Name | 3-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-N-(4-methyl-3-sulfamoylphenyl)benzamide |
| InChI | InChI=1S/C20H21N3O5S/c1-12-7-8-16(10-19(12)29(21,25)26)22-20(24)15-5-4-6-17(9-15)27-11-18-13(2)23-28-14(18)3/h4-10H,11H2,1-3H3,(H,22,24)(H2,21,25,26) |
| InChIKey | OZZQJOAJXMUXCO-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NC(=O)C2=CC(=CC=C2)OCC3=C(ON=C3C)C)S(=O)(=O)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
