For research use only. Not for therapeutic Use.
Z-Phe-Ala-diazomethylketone(CAT: I040413) is an irreversible cysteine protease inhibitor that selectively targets enzymes such as cathepsins B, L, and H. Featuring a diazomethylketone warhead, it covalently modifies the active site thiol group, leading to permanent inactivation. The Z (benzyloxycarbonyl) group and Phe-Ala dipeptide sequence confer specificity and enhanced cell permeability. This compound is widely used in studies involving lysosomal proteolysis, antigen processing, and protease-related signaling pathways. Its stable and potent inhibitory profile makes it ideal for mechanistic enzymology, drug target validation, and inhibitor screening. Supplied at high purity, Z-Phe-Ala-diazomethylketone supports advanced research in cell biology and protease regulation.
| CAS Number | 71732-53-1 |
| Synonyms | benzyl N-[(2S)-1-[[(2S)-4-diazo-3-oxobutan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
| Molecular Formula | C21H22N4O4 |
| Purity | ≥95% |
| IUPAC Name | benzyl N-[(2S)-1-[[(2S)-4-diazo-3-oxobutan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
| InChI | InChI=1S/C21H22N4O4/c1-15(19(26)13-23-22)24-20(27)18(12-16-8-4-2-5-9-16)25-21(28)29-14-17-10-6-3-7-11-17/h2-11,13,15,18H,12,14H2,1H3,(H,24,27)(H,25,28)/t15-,18-/m0/s1 |
| InChIKey | QMPATRQNERZOMF-YJBOKZPZSA-N |
| SMILES | CC(C(=O)C=[N+]=[N-])NC(=O)C(CC1=CC=CC=C1)NC(=O)OCC2=CC=CC=C2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
