For research use only. Not for therapeutic Use.
Z-Arg-SBzl（Cat No.:I041119）is a synthetic peptide derivative used as a substrate in biochemical research, particularly in the study of proteases such as trypsin or caspases. The “Z” refers to the benzyloxycarbonyl group, which is a protective group used to prevent unwanted reactivity, while “Arg” represents arginine, an amino acid, and “SBzl” refers to the benzyl ester group attached to the carboxylate of the peptide. Z-Arg-SBzl is commonly employed in enzyme assays to measure enzyme activity, particularly in assays assessing protease cleavage, and it plays a role in drug discovery and molecular biology studies.
| CAS Number | 88253-86-5 |
| Synonyms | S-benzyl (2S)-5-(diaminomethylideneamino)-2-(phenylmethoxycarbonylamino)pentanethioate |
| Molecular Formula | C21H26N4O3S |
| Purity | ≥95% |
| IUPAC Name | S-benzyl (2S)-5-(diaminomethylideneamino)-2-(phenylmethoxycarbonylamino)pentanethioate |
| InChI | InChI=1S/C21H26N4O3S/c22-20(23)24-13-7-12-18(19(26)29-15-17-10-5-2-6-11-17)25-21(27)28-14-16-8-3-1-4-9-16/h1-6,8-11,18H,7,12-15H2,(H,25,27)(H4,22,23,24)/t18-/m0/s1 |
| InChIKey | FUGAPOARIHJRAG-SFHVURJKSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@@H](CCCN=C(N)N)C(=O)SCC2=CC=CC=C2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
