For research use only. Not for therapeutic Use.
(Z)-11-Tetradecenyl acetate is a chemical compound found in the pheromones of certain insects, particularly moths. It acts as a sex attractant, aiding in mating communication between individuals of the same species. Synthetic versions of this compound are utilized in pest management strategies, such as lures and traps, to monitor or control moth populations in agricultural settings, reducing crop damage and pesticide use.
| CAS Number | 20711-10-8 |
| Synonyms | (11Z)-11-Tetradecen-1-ol 1-Acetate; (11Z)-11-Tetradecen-1-ol Acetate; (Z)-11-Tetradecen-1-ol Acetate; (Z)-11-Tetradecen-1-yl Acetate; 11-cis-Tetradecen-1-yl Acetate; Hamaki-con; Z 11-14Ac; cis-11-Tetradecen-1-ol Acetate; cis-11-Tetradecen-1-yl Aceta |
| Molecular Formula | C16H30O2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | [(Z)-tetradec-11-enyl] acetate |
| InChI | InChI=1S/C16H30O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-18-16(2)17/h4-5H,3,6-15H2,1-2H3/b5-4- |
| InChIKey | YJINQJFQLQIYHX-PLNGDYQASA-N |
| SMILES | CCC=CCCCCCCCCCCOC(=O)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |