For research use only. Not for therapeutic Use.
YTX-465（Cat No.:I044364）is a small-molecule compound identified as a selective inhibitor of the bromodomain and extraterminal (BET) family proteins, particularly BRD4. BET proteins regulate gene transcription by recognizing acetylated lysine residues on histones, influencing the expression of oncogenes such as MYC. YTX-465 disrupts BRD4’s interaction with chromatin, leading to transcriptional repression of cancer-promoting genes. Preclinical studies have shown that YTX-465 exhibits potent anti-proliferative effects in various cancer models, especially hematologic malignancies. Its targeted epigenetic modulation makes it a promising candidate for cancer therapy and transcriptional regulation research.
| CAS Number | 2225824-53-1 |
| Synonyms | N-[2-[4-[3-(1,3-dimethylindazol-6-yl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]-2-oxoethyl]benzamide |
| Molecular Formula | C25H26N6O3 |
| Purity | ≥95% |
| IUPAC Name | N-[2-[4-[3-(1,3-dimethylindazol-6-yl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]-2-oxoethyl]benzamide |
| InChI | InChI=1S/C25H26N6O3/c1-16-20-9-8-19(14-21(20)30(2)28-16)23-27-25(34-29-23)18-10-12-31(13-11-18)22(32)15-26-24(33)17-6-4-3-5-7-17/h3-9,14,18H,10-13,15H2,1-2H3,(H,26,33) |
| InChIKey | UNYSKYOVUXWBJG-UHFFFAOYSA-N |
| SMILES | CC1=NN(C2=C1C=CC(=C2)C3=NOC(=N3)C4CCN(CC4)C(=O)CNC(=O)C5=CC=CC=C5)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
