For research use only. Not for therapeutic Use.
YS-370（Cat No.:I044173）is a potent and selective inhibitor of lysine-specific demethylase 1 (LSD1/KDM1A), an epigenetic regulator involved in histone H3K4 demethylation and gene silencing. By inhibiting LSD1, YS-370 reactivates the expression of genes critical for cell differentiation and apoptosis, making it a promising compound in cancer research, particularly for acute myeloid leukemia (AML) and other malignancies with epigenetic dysregulation. YS-370 has shown strong antiproliferative effects in preclinical models. It serves as a valuable tool for exploring LSD1’s role in gene regulation and potential therapeutic targeting in oncology.
| CAS Number | 2470908-79-1 |
| Synonyms | 4-[3-[4-[1-[(2-bromophenyl)methyl]-2-phenylindol-3-yl]-7-methoxyquinazolin-6-yl]oxypropyl]morpholine |
| Molecular Formula | C37H35BrN4O3 |
| Purity | ≥95% |
| IUPAC Name | 4-[3-[4-[1-[(2-bromophenyl)methyl]-2-phenylindol-3-yl]-7-methoxyquinazolin-6-yl]oxypropyl]morpholine |
| InChI | InChI=1S/C37H35BrN4O3/c1-43-33-23-31-29(22-34(33)45-19-9-16-41-17-20-44-21-18-41)36(40-25-39-31)35-28-13-6-8-15-32(28)42(24-27-12-5-7-14-30(27)38)37(35)26-10-3-2-4-11-26/h2-8,10-15,22-23,25H,9,16-21,24H2,1H3 |
| InChIKey | WSOJDUFWINGDJI-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)N=CN=C2C3=C(N(C4=CC=CC=C43)CC5=CC=CC=C5Br)C6=CC=CC=C6)OCCCN7CCOCC7 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
