For research use only. Not for therapeutic Use.
YM-341619（Cat No.:I044544）is a potent and selective antagonist of the human histamine H4 receptor, which plays a key role in immune cell chemotaxis and inflammatory responses. By blocking H4 receptor signaling, YM-341619 reduces the recruitment and activation of eosinophils, mast cells, and other immune cells involved in allergic and inflammatory diseases. Preclinical studies have demonstrated its effectiveness in models of asthma and dermatitis, highlighting its potential as a novel therapeutic agent for chronic inflammatory and allergic conditions. YM-341619 provides a valuable tool for elucidating H4 receptor functions in immune regulation.
| CAS Number | 643082-52-4 |
| Synonyms | 2-(4-morpholin-4-ylanilino)-4-[(2,3,6-trifluorophenyl)methylamino]pyrimidine-5-carboxamide |
| Molecular Formula | C22H21F3N6O2 |
| Purity | ≥95% |
| IUPAC Name | 2-(4-morpholin-4-ylanilino)-4-[(2,3,6-trifluorophenyl)methylamino]pyrimidine-5-carboxamide |
| InChI | InChI=1S/C22H21F3N6O2/c23-17-5-6-18(24)19(25)15(17)11-27-21-16(20(26)32)12-28-22(30-21)29-13-1-3-14(4-2-13)31-7-9-33-10-8-31/h1-6,12H,7-11H2,(H2,26,32)(H2,27,28,29,30) |
| InChIKey | IUUUCMFTTBSFIT-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=CC=C(C=C2)NC3=NC=C(C(=N3)NCC4=C(C=CC(=C4F)F)F)C(=O)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
