For research use only. Not for therapeutic Use.
Tert-butyl 4-(3,3,3-trifluoro-2-hydroxypropyl)piperidine-1-carboxylate (Cat No.:R074215) is a synthetic compound with a piperidine core, bearing a tert-butyl ester and a trifluoro-2-hydroxypropyl group. This compound finds applications in pharmaceutical research and organic synthesis as a potential intermediate for drug development or bioactive molecules. The trifluoro-2-hydroxypropyl group adds fluorine atoms, which can enhance the compound’s properties.
| CAS Number | 1228631-10-4 |
| Molecular Formula | C13H22F3NO3 |
| Purity | ≥95% |
| Storage | 2-8°C |
| IUPAC Name | tert-butyl 4-(3,3,3-trifluoro-2-hydroxypropyl)piperidine-1-carboxylate |
| InChI | InChI=1S/C13H22F3NO3/c1-12(2,3)20-11(19)17-6-4-9(5-7-17)8-10(18)13(14,15)16/h9-10,18H,4-8H2,1-3H3 |
| InChIKey | YLPPNASJYIAVQZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)CC(C(F)(F)F)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |