For research use only. Not for therapeutic Use.
Yhhu-3792（Cat No.:I043738）is a selective small molecule inhibitor targeting the enzyme TGF-β receptor type 1 (TGFBR1), which plays a critical role in the TGF-β signaling pathway, involved in processes such as cell growth, differentiation, and fibrosis. By inhibiting TGFBR1, Yhhu-3792 suppresses the TGF-β pathway, making it a promising candidate for treating fibrotic diseases, cancer, and other conditions where TGF-β signaling is dysregulated. Preclinical studies suggest that Yhhu-3792 may help reduce fibrosis and limit tumor progression, offering potential therapeutic benefits in oncology and fibrosis-related diseases.
| CAS Number | 2097826-24-7 |
| Synonyms | 5-(3-methoxyphenoxy)-2-N-(4-propan-2-ylphenyl)quinazoline-2,4-diamine |
| Molecular Formula | C24H24N4O2 |
| Purity | ≥95% |
| IUPAC Name | 5-(3-methoxyphenoxy)-2-N-(4-propan-2-ylphenyl)quinazoline-2,4-diamine |
| InChI | InChI=1S/C24H24N4O2/c1-15(2)16-10-12-17(13-11-16)26-24-27-20-8-5-9-21(22(20)23(25)28-24)30-19-7-4-6-18(14-19)29-3/h4-15H,1-3H3,(H3,25,26,27,28) |
| InChIKey | PDGVGAAXMRKVPG-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)NC2=NC3=C(C(=CC=C3)OC4=CC=CC(=C4)OC)C(=N2)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
