For research use only. Not for therapeutic Use.
Xylotriose（Cat No.:R032341）is a trisaccharide composed of three xylose units linked by β-1,4-glycosidic bonds, belonging to the family of xylooligosaccharides (XOS). It is naturally derived from the enzymatic breakdown of xylan, a major component of plant cell walls. Xylotriose is widely studied for its prebiotic activity, as it selectively stimulates beneficial gut microbiota such as Bifidobacterium and Lactobacillus. Beyond gut health, it contributes to improved digestion, immune regulation, and metabolic balance. With its functional food and nutraceutical potential, xylotriose represents a valuable ingredient in dietary and health-promoting applications.
| CAS Number | 47592-59-6 |
| Synonyms | (2R,3R,4R)-4-[(2S,3R,4R,5R)-3,4-dihydroxy-5-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-2,3,5-trihydroxypentanal |
| Molecular Formula | C15H26O13 |
| Purity | ≥95% |
| IUPAC Name | (3R,4S,5R)-2-[(4S,5S,6R)-4,5-dihydroxy-6-[(3R,4R,5R)-4,5,6-trihydroxyoxan-3-yl]oxyoxan-3-yl]oxyoxane-3,4,5-triol |
| InChI | InChI=1S/C15H26O13/c16-4-1-25-14(11(21)7(4)17)28-6-3-26-15(12(22)9(6)19)27-5-2-24-13(23)10(20)8(5)18/h4-23H,1-3H2/t4-,5-,6?,7+,8+,9-,10-,11-,12+,13?,14?,15-/m1/s1 |
| InChIKey | JCSJTDYCNQHPRJ-QZPPXLSYSA-N |
| SMILES | C1[C@H]([C@@H]([C@H](C(O1)OC2CO[C@@H]([C@H]([C@@H]2O)O)O[C@@H]3COC([C@@H]([C@H]3O)O)O)O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
