For research use only. Not for therapeutic Use.
Xylitol (Cat No.:I005292 ) is a sugar alcohol used as a sweetener in food, dental products, and medications. It occurs naturally in fruits and vegetables, and is often used as a sugar substitute due to its lower glycemic index and fewer calories. Xylitol has dental health benefits, as it helps reduce the growth of bacteria that cause cavities and tooth decay. It also has a lower impact on blood sugar levels compared to regular sugar, making it suitable for people with diabetes. However, it can cause digestive issues in large quantities.
| CAS Number | 87-99-0 |
| Molecular Formula | C5H12O5 |
| Purity | ≥95% |
| Target | Metabolic Enzyme/Protease |
| Solubility | H2O: 50 mg/mL |
| Storage | Desiccate at +4 ℃ |
| IUPAC Name | (2S,4R)-pentane-1,2,3,4,5-pentol |
| InChI | InChI=1S/C5H12O5/c6-1-3(8)5(10)4(9)2-7/h3-10H,1-2H2/t3-,4+,5? |
| InChIKey | HEBKCHPVOIAQTA-NGQZWQHPSA-N |
| SMILES | C([C@H](C([C@H](CO)O)O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |