For research use only. Not for therapeutic Use.
Xanthurenic Acid (Cat.No:R049798) is a metabolite formed during the degradation of tryptophan, an essential amino acid. It plays a role in regulating immune responses and has been linked to neurological and metabolic disorders. Xanthurenic Acid’s interactions with biological pathways make it an area of interest in research related to health and disease.
| CAS Number | 59-00-7 |
| Synonyms | 4,8-Dihydroxy-2-quinolinecarboxylic Acid; 4,8-Dihydroxyquinaldic Acid; 8-Hydroxykynurenic Acid; NSC 401570; Xanthuric Acid; |
| Molecular Formula | C10H7NO4 |
| Purity | ≥95% |
| Target | GluR |
| Solubility | Soluble in DMSO > 10 mM |
| Storage | Store at RT |
| IUPAC Name | 8-hydroxy-4-oxo-1H-quinoline-2-carboxylic acid |
| InChI | InChI=1S/C10H7NO4/c12-7-3-1-2-5-8(13)4-6(10(14)15)11-9(5)7/h1-4,12H,(H,11,13)(H,14,15) |
| InChIKey | FBZONXHGGPHHIY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)O)NC(=CC2=O)C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |