For research use only. Not for therapeutic Use.
Xanthine(CAT: R051339) is a purine base and naturally occurring intermediate in the metabolic degradation of purine nucleotides to uric acid in humans and other organisms. Structurally composed of a fused pyrimidine and imidazole ring, xanthine is central to studies involving nucleic acid metabolism, enzymology, and oxidative stress. It serves as a substrate for key enzymes such as xanthine oxidase and xanthine dehydrogenase, making it valuable for investigating reactive oxygen species generation and gout-related pathways.
CAS Number | 69-89-6 |
Synonyms | 3,9-Dihydro-1H-purine-2,6-dione; 1H,3H,7H-Xanthine; 1H,3H,9H-Xanthine; 1H-Purine-2,6-diol; 2,6-Dioxo-1,2,3,6-tetrahydropurine; 2,6-Dioxopurine; 3,9-Dihydro-1H-purine-2,6-dione; 3,9-Dihydropurine-2,6-dione; 9H-Purine-2,6(1H,3H)-dione; Isoxanthine; NSC |
Molecular Formula | C5H4N4O2 |
Purity | ≥95% |
Storage | 3 years -20C powder |
IUPAC Name | 3,7-dihydropurine-2,6-dione |
InChI | InChI=1S/C5H4N4O2/c10-4-2-3(7-1-6-2)8-5(11)9-4/h1H,(H3,6,7,8,9,10,11) |
InChIKey | LRFVTYWOQMYALW-UHFFFAOYSA-N |
SMILES | C1=NC2=C(N1)C(=O)NC(=O)N2 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |