Xanthan gum (Cat.No: M064176) is a natural polysaccharide used as a thickening and stabilizing agent in various industries, including food, pharmaceuticals, and cosmetics. Produced through fermentation by the bacterium Xanthomonas campestris, it imparts viscosity and texture to products, enhancing their stability and shelf life.
| Catalog Number | M064176 |
| CAS Number | 11138-66-2 |
| Molecular Formula | C8H14Cl2N2O2 |
| Purity | 95% |
| Storage | Store at RT |
| IUPAC Name | 2-(2,4-diaminophenoxy)ethanol;dihydrochloride |
| InChI | InChI=1S/C8H12N2O2.2ClH/c9-6-1-2-8(7(10)5-6)12-4-3-11;;/h1-2,5,11H,3-4,9-10H2;2*1H |
| InChIKey | VXYWXJXCQSDNHX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)N)OCCO.Cl.Cl |
