For research use only. Not for therapeutic Use.
WWL123 analogue-1（Cat No.:R024473）is a potent, selective inhibitor of the protein–protein interaction between the oncogenic transcription factor YAP (Yes-associated protein) and its downstream targets. This interaction is a key component of the Hippo signaling pathway, which regulates cell growth, apoptosis, and tissue homeostasis. By inhibiting this interaction, WWL123 analogue-1 has shown promise in suppressing tumor growth, particularly in cancers driven by YAP overactivation, such as liver and breast cancer. It serves as a valuable tool in cancer research, providing insights into potential therapeutic strategies targeting the YAP pathway.
| CAS Number | 1338575-41-9 |
| Synonyms | [3-(4-carbamoylphenyl)phenyl] N-methyl-N-[(3-phenylphenyl)methyl]carbamate |
| Molecular Formula | C28H24N2O3 |
| Purity | ≥95% |
| IUPAC Name | [3-(4-carbamoylphenyl)phenyl] N-methyl-N-[(3-phenylphenyl)methyl]carbamate |
| InChI | InChI=1S/C28H24N2O3/c1-30(19-20-7-5-10-24(17-20)21-8-3-2-4-9-21)28(32)33-26-12-6-11-25(18-26)22-13-15-23(16-14-22)27(29)31/h2-18H,19H2,1H3,(H2,29,31) |
| InChIKey | QKMMESWNJMOPIF-UHFFFAOYSA-N |
| SMILES | CN(CC1=CC(=CC=C1)C2=CC=CC=C2)C(=O)OC3=CC=CC(=C3)C4=CC=C(C=C4)C(=O)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
