For research use only. Not for therapeutic Use.
WNK-IN-11-d3(Cat No.:S000282) is a deuterated form of WNK-IN-11, where three hydrogen atoms are replaced with deuterium, enhancing its molecular stability. This modification makes it an excellent internal standard for analytical techniques such as mass spectrometry and NMR spectroscopy. WNK-IN-11 is a specific inhibitor of WNK kinases, which are involved in regulating ion balance and blood pressure. By incorporating deuterium, WNK-IN-11-d3 provides a tool for more accurate pharmacokinetic and pharmacodynamic studies, allowing researchers to better understand the drug’s mechanism of action and its interactions within biological systems.
CAS Number | 2123483-49-6 |
Molecular Formula | C21H18D3Cl2N5OS |
Purity | ≥95% |
Target | Ser/Thr Protease |
IUPAC Name | [4-[(4-chlorophenyl)methyl]piperazin-1-yl]-[5-chloro-2-[2-(trideuteriomethylamino)-1,3-thiazol-4-yl]pyridin-4-yl]methanone |
InChI | InChI=1S/C21H21Cl2N5OS/c1-24-21-26-19(13-30-21)18-10-16(17(23)11-25-18)20(29)28-8-6-27(7-9-28)12-14-2-4-15(22)5-3-14/h2-5,10-11,13H,6-9,12H2,1H3,(H,24,26)/i1D3 |
InChIKey | MVXAYIXYYOVALX-FIBGUPNXSA-N |
SMILES | CNC1=NC(=CS1)C2=NC=C(C(=C2)C(=O)N3CCN(CC3)CC4=CC=C(C=C4)Cl)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |