For research use only. Not for therapeutic Use.
Wiskostatin（Cat No.:R061889）is a small-molecule inhibitor that targets N-WASP (Neural Wiskott-Aldrich Syndrome Protein), a key regulator of actin cytoskeleton remodeling. By stabilizing the autoinhibited conformation of N-WASP, Wiskostatin prevents its activation by Cdc42, thereby blocking Arp2/3 complex-mediated actin polymerization. This disruption affects various cellular processes such as endocytosis, membrane trafficking, and cell motility. Wiskostatin is widely used in cell biology research to study actin dynamics, signal transduction, and cytoskeletal regulation. Its specific inhibition of N-WASP makes it a valuable tool for dissecting actin-dependent mechanisms in both normal and disease contexts.
| CAS Number | 253449-04-6 |
| Synonyms | 1-(3,6-dibromocarbazol-9-yl)-3-(dimethylamino)propan-2-ol |
| Molecular Formula | C17H18Br2N2O |
| Purity | ≥95% |
| IUPAC Name | 1-(3,6-dibromocarbazol-9-yl)-3-(dimethylamino)propan-2-ol |
| InChI | InChI=1S/C17H18Br2N2O/c1-20(2)9-13(22)10-21-16-5-3-11(18)7-14(16)15-8-12(19)4-6-17(15)21/h3-8,13,22H,9-10H2,1-2H3 |
| InChIKey | XUBJEDZHBUPBKL-UHFFFAOYSA-N |
| SMILES | CN(C)CC(CN1C2=C(C=C(C=C2)Br)C3=C1C=CC(=C3)Br)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
