For research use only. Not for therapeutic Use.
Windaus ketone(CAT: R046934) is a pivotal intermediate in the synthesis of vitamin D3 and related secosteroids, named after Nobel Prize-winning chemist Adolf Windaus. Structurally characterized by a 3-oxo-9,10-secopregna-5,7,10(19)-triene framework, it serves as a crucial precursor in both photochemical and thermal transformations that emulate natural vitamin D biosynthesis. Windaus ketone is widely used in the pharmaceutical industry for the development of vitamin D analogs, which are investigated for their roles in bone metabolism, autoimmune diseases, and cancer therapy. Its well-defined triene system and synthetic versatility make it an essential compound in steroid chemistry and medicinal research.
| CAS Number | 55812-80-1 |
| Synonyms | (1R,3aR,7aR)-1-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
| Molecular Formula | C19H32O |
| Purity | ≥95% |
| IUPAC Name | (1R,3aR,7aR)-1-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
| InChI | InChI=1S/C19H32O/c1-13(2)14(3)8-9-15(4)16-10-11-17-18(20)7-6-12-19(16,17)5/h8-9,13-17H,6-7,10-12H2,1-5H3/b9-8+/t14-,15+,16+,17-,19+/m0/s1 |
| InChIKey | VJIOBQLKFJUZJB-IBOOZMTFSA-N |
| SMILES | CC(C)C(C)C=CC(C)C1CCC2C1(CCCC2=O)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
