For research use only. Not for therapeutic Use.
2-(2-Chlorophenyl)-N-(4-pyridin-4-yl-1,3-thiazol-2-yl)acetamide(CAT: I040491) is a heterocyclic acetamide compound featuring a 2-chlorophenyl group and a thiazole-pyridine moiety. Its structure offers multiple points of interaction with biological targets, making it a promising scaffold for drug discovery, particularly in anti-inflammatory, anticancer, or antimicrobial research. The chlorinated aromatic ring enhances lipophilicity and potential membrane permeability, while the thiazole-pyridine fragment contributes to target specificity and binding affinity. This compound is suitable for structure–activity relationship (SAR) studies, receptor profiling, and pharmacological screening. Supplied in high purity, it is ideal for medicinal chemistry, chemical biology, and preclinical research applications.
| CAS Number | 692869-98-0 |
| Synonyms | 2-(2-chlorophenyl)-N-(4-pyridin-4-yl-1,3-thiazol-2-yl)acetamide |
| Molecular Formula | C16H12ClN3OS |
| Purity | ≥95% |
| IUPAC Name | 2-(2-chlorophenyl)-N-(4-pyridin-4-yl-1,3-thiazol-2-yl)acetamide |
| InChI | InChI=1S/C16H12ClN3OS/c17-13-4-2-1-3-12(13)9-15(21)20-16-19-14(10-22-16)11-5-7-18-8-6-11/h1-8,10H,9H2,(H,19,20,21) |
| InChIKey | MFGRJJFHPIQYGH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC(=O)NC2=NC(=CS2)C3=CC=NC=C3)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
