For research use only. Not for therapeutic Use.
5-Methyl-4-phenyl-2-thiophen-2-yl-1,3-thiazole(CAT: I040485) is a compact, conjugated heterocyclic compound featuring a thiazole core substituted with both phenyl and thiophene rings, along with a methyl group at the 5-position. This structural arrangement imparts aromaticity and electronic versatility, making it attractive for use in pharmaceutical research, organic electronics, and materials science. Its thiazole-thiophene framework is often explored in the development of antimicrobial, anticancer, and anti-inflammatory agents. Additionally, the extended π-system lends itself well to studies in fluorescence and charge transport. The compound’s balanced lipophilicity and rigidity make it an ideal scaffold for SAR studies or as a building block in drug design.
| CAS Number | 113214-30-5 |
| Synonyms | 5-methyl-4-phenyl-2-thiophen-2-yl-1,3-thiazole |
| Molecular Formula | C14H11NS2 |
| Purity | ≥95% |
| IUPAC Name | 5-methyl-4-phenyl-2-thiophen-2-yl-1,3-thiazole |
| InChI | InChI=1S/C14H11NS2/c1-10-13(11-6-3-2-4-7-11)15-14(17-10)12-8-5-9-16-12/h2-9H,1H3 |
| InChIKey | GJCUAOPBECGQBG-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(S1)C2=CC=CS2)C3=CC=CC=C3 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
