For research use only. Not for therapeutic Use.
3,3,9-Trimethyl-2,4-dihydroacridin-1-one(CAT: I040467) is a synthetic acridone derivative featuring a tricyclic core substituted with three methyl groups. This compound is notable for its unique structural rigidity and conjugated system, making it valuable in medicinal chemistry and photophysical studies. It serves as a versatile scaffold for the development of fluorescent probes, enzyme inhibitors, and anticancer agents due to its potential to intercalate DNA or modulate redox activity. Additionally, its stability and lipophilic nature support its use in drug discovery and chemical biology applications. Ideal for research exploring acridone-based therapeutics or molecular imaging tools in oncology and biochemical pathways.
| CAS Number | 851901-67-2 |
| Synonyms | 3,3,9-trimethyl-2,4-dihydroacridin-1-one |
| Molecular Formula | C16H17NO |
| Purity | ≥95% |
| IUPAC Name | 3,3,9-trimethyl-2,4-dihydroacridin-1-one |
| InChI | InChI=1S/C16H17NO/c1-10-11-6-4-5-7-12(11)17-13-8-16(2,3)9-14(18)15(10)13/h4-7H,8-9H2,1-3H3 |
| InChIKey | XSNVNXWXTVHWSE-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=NC3=CC=CC=C13)CC(CC2=O)(C)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
