For research use only. Not for therapeutic Use.
5-bromo-N-(2-morpholin-4-ylethyl)pyridine-3-carboxamide(CAT: I040344) is a brominated pyridine derivative featuring a morpholine-substituted ethylamide side chain. Its unique structure combines a halogenated aromatic core with a polar, nitrogen-rich heterocycle, making it a promising scaffold for medicinal chemistry applications. This compound is of interest in the development of kinase inhibitors, CNS-active agents, and modulators of receptor-ligand interactions due to its potential bioavailability and receptor-binding affinity. Its synthetic versatility also makes it suitable for structure–activity relationship (SAR) studies and lead compound optimization. An ideal research reagent in drug discovery and chemical biology.
| CAS Number | 515866-67-8 |
| Synonyms | 5-bromo-N-(2-morpholin-4-ylethyl)pyridine-3-carboxamide |
| Molecular Formula | C12H16BrN3O2 |
| Purity | ≥95% |
| IUPAC Name | 5-bromo-N-(2-morpholin-4-ylethyl)pyridine-3-carboxamide |
| InChI | InChI=1S/C12H16BrN3O2/c13-11-7-10(8-14-9-11)12(17)15-1-2-16-3-5-18-6-4-16/h7-9H,1-6H2,(H,15,17) |
| InChIKey | HRJAFCAVJHVTOR-UHFFFAOYSA-N |
| SMILES | C1COCCN1CCNC(=O)C2=CC(=CN=C2)Br |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
