For research use only. Not for therapeutic Use.
[2,3-Bis(furan-2-yl)quinoxalin-6-yl]-phenylmethanone(CAT: I040477) is a polyheterocyclic aromatic compound featuring a quinoxaline core substituted with two furan rings at positions 2 and 3, and a phenylmethanone (benzoyl) moiety at position 6. This structurally rigid and conjugated molecule is of interest in medicinal chemistry due to its potential as an inhibitor of kinases, redox enzymes, or DNA-interacting proteins. The extended π-system and heteroatom-rich framework support favorable binding interactions and bioactivity. It is suitable for applications in anticancer, antimicrobial, or anti-inflammatory research, and is a valuable scaffold for SAR development. Supplied in high purity, ideal for pharmacological and chemical biology studies.
| CAS Number | 312590-55-9 |
| Synonyms | [2,3-bis(furan-2-yl)quinoxalin-6-yl]-phenylmethanone |
| Molecular Formula | C23H14N2O3 |
| Purity | ≥95% |
| IUPAC Name | [2,3-bis(furan-2-yl)quinoxalin-6-yl]-phenylmethanone |
| InChI | InChI=1S/C23H14N2O3/c26-23(15-6-2-1-3-7-15)16-10-11-17-18(14-16)25-22(20-9-5-13-28-20)21(24-17)19-8-4-12-27-19/h1-14H |
| InChIKey | JMIHJEGISAXHQH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC3=C(C=C2)N=C(C(=N3)C4=CC=CO4)C5=CC=CO5 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
