For research use only. Not for therapeutic Use.
N-[2-(4-fluorophenyl)ethyl]furan-2-carboxamide(CAT: I040521) is a small molecule featuring a fluorinated aromatic moiety and a furan carboxamide scaffold, making it a versatile compound for medicinal chemistry and drug discovery research. The 4-fluorophenylethyl group enhances lipophilicity and potential receptor binding affinity, while the furan-2-carboxamide core contributes to metabolic stability and bioactivity. This compound is suitable for structure–activity relationship (SAR) studies, particularly in the exploration of central nervous system (CNS) agents or anti-inflammatory leads. Its physicochemical profile supports further functionalization and analog synthesis. Provided in high purity, N-[2-(4-fluorophenyl)ethyl]furan-2-carboxamide is ideal for exploratory pharmacological and chemical biology research.
| CAS Number | 380469-52-3 |
| Synonyms | N-[2-(4-fluorophenyl)ethyl]furan-2-carboxamide |
| Molecular Formula | C13H12FNO2 |
| Purity | ≥95% |
| IUPAC Name | N-[2-(4-fluorophenyl)ethyl]furan-2-carboxamide |
| InChI | InChI=1S/C13H12FNO2/c14-11-5-3-10(4-6-11)7-8-15-13(16)12-2-1-9-17-12/h1-6,9H,7-8H2,(H,15,16) |
| InChIKey | GSMVTQDRELNXRQ-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C(=O)NCCC2=CC=C(C=C2)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
