For research use only. Not for therapeutic Use.
4-[5-[(2-Chloro-6-fluorophenyl)methylsulfanyl]-4-phenyl-1,2,4-triazol-3-yl]pyridine(CAT: I040458) is a heteroaryl compound featuring a 1,2,4-triazole core substituted with phenyl, pyridyl, and halogenated arylthio groups. The triazole moiety, known for its bioisosteric properties and metabolic resilience, is widely used in medicinal chemistry for designing enzyme inhibitors, antifungal agents, or kinase modulators. The inclusion of a chloro-fluoro-substituted phenylthio group enhances lipophilicity and potential target binding affinity, while the pyridine ring may improve solubility and receptor interaction. This compound serves as a valuable scaffold for drug discovery and optimization programs, particularly in oncology, infectious disease, or inflammatory pathway research.
| CAS Number | 521281-98-1 |
| Synonyms | 4-[5-[(2-chloro-6-fluorophenyl)methylsulfanyl]-4-phenyl-1,2,4-triazol-3-yl]pyridine |
| Molecular Formula | C20H14ClFN4S |
| Purity | ≥95% |
| IUPAC Name | 4-[5-[(2-chloro-6-fluorophenyl)methylsulfanyl]-4-phenyl-1,2,4-triazol-3-yl]pyridine |
| InChI | InChI=1S/C20H14ClFN4S/c21-17-7-4-8-18(22)16(17)13-27-20-25-24-19(14-9-11-23-12-10-14)26(20)15-5-2-1-3-6-15/h1-12H,13H2 |
| InChIKey | DOEXDLBKXKSGQU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=NN=C2SCC3=C(C=CC=C3Cl)F)C4=CC=NC=C4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
