For research use only. Not for therapeutic Use.
1-(1-Benzylpiperidin-4-yl)-3-(2-fluorophenyl)thiourea(CAT: I040597) is a synthetic small molecule known for its high affinity to the sigma-1 receptor, a chaperone protein involved in modulating ion channels, neurotransmitter release, and cellular stress responses. This compound is frequently used in neuropharmacological research to explore the sigma-1 receptor’s role in neurodegenerative diseases, pain modulation, and psychiatric disorders. Its structural features, including a piperidine core and fluorinated aryl group, contribute to potent binding and CNS activity. Ideal for in vitro receptor-binding assays and in vivo behavioral studies, this thiourea derivative serves as a valuable chemical tool for investigating sigma-1 receptor-mediated signaling pathways.
| CAS Number | 850023-52-8 |
| Synonyms | 1-(1-benzylpiperidin-4-yl)-3-(2-fluorophenyl)thiourea |
| Molecular Formula | C19H22FN3S |
| Purity | ≥95% |
| IUPAC Name | 1-(1-benzylpiperidin-4-yl)-3-(2-fluorophenyl)thiourea |
| InChI | InChI=1S/C19H22FN3S/c20-17-8-4-5-9-18(17)22-19(24)21-16-10-12-23(13-11-16)14-15-6-2-1-3-7-15/h1-9,16H,10-14H2,(H2,21,22,24) |
| InChIKey | DHNRHIJFIBDZKT-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1NC(=S)NC2=CC=CC=C2F)CC3=CC=CC=C3 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
