For research use only. Not for therapeutic Use.
N-(6-acetyl-1,3-benzodioxol-5-yl)-2-bromobenzenesulfonamide(CAT: I040350) is a synthetically engineered small molecule that combines a brominated benzenesulfonamide group with an acetylated benzodioxole moiety. The presence of both electron-donating and electron-withdrawing groups suggests potential bioactivity, particularly in the inhibition of enzymes such as kinases or sulfonamide-sensitive hydrolases. Its structural framework is suitable for use in medicinal chemistry and pharmacological screening, especially in cancer, inflammation, or CNS-related pathways. This compound serves as a valuable tool for structure–activity relationship (SAR) analysis and lead optimization studies.
| CAS Number | 460994-47-2 |
| Synonyms | N-(6-acetyl-1,3-benzodioxol-5-yl)-2-bromobenzenesulfonamide |
| Molecular Formula | C15H12BrNO5S |
| Purity | ≥95% |
| IUPAC Name | N-(6-acetyl-1,3-benzodioxol-5-yl)-2-bromobenzenesulfonamide |
| InChI | InChI=1S/C15H12BrNO5S/c1-9(18)10-6-13-14(22-8-21-13)7-12(10)17-23(19,20)15-5-3-2-4-11(15)16/h2-7,17H,8H2,1H3 |
| InChIKey | NFOIEEPIYDXZNN-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC2=C(C=C1NS(=O)(=O)C3=CC=CC=C3Br)OCO2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
