For research use only. Not for therapeutic Use.
4-(3,5-Dimethylpyrazol-1-yl)-N-(4-methyl-1,3-thiazol-2-yl)benzamide(CAT: I040479) is a multifunctional heterocyclic compound featuring a benzamide core substituted with both a dimethylpyrazole and a methylthiazole moiety. This combination of aromatic and heterocyclic groups contributes to a rich pharmacophoric profile, making it a valuable scaffold for drug discovery and medicinal chemistry research. The compound offers potential for activity in anti-inflammatory, antimicrobial, or kinase inhibition pathways due to its hydrogen bonding capabilities and metabolic stability. Its structural features make it suitable for structure–activity relationship (SAR) studies, target binding investigations, and lead optimization efforts. Supplied in high purity, it is ideal for pharmacological and biochemical research.
| CAS Number | 956959-79-8 |
| Synonyms | 4-(3,5-dimethylpyrazol-1-yl)-N-(4-methyl-1,3-thiazol-2-yl)benzamide |
| Molecular Formula | C16H16N4OS |
| Purity | ≥95% |
| IUPAC Name | 4-(3,5-dimethylpyrazol-1-yl)-N-(4-methyl-1,3-thiazol-2-yl)benzamide |
| InChI | InChI=1S/C16H16N4OS/c1-10-8-12(3)20(19-10)14-6-4-13(5-7-14)15(21)18-16-17-11(2)9-22-16/h4-9H,1-3H3,(H,17,18,21) |
| InChIKey | PESUEAIIRVMTGX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1C2=CC=C(C=C2)C(=O)NC3=NC(=CS3)C)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
