For research use only. Not for therapeutic Use.
N-Cyclopentyl-5-(4-fluorophenyl)-1,2-oxazole-3-carboxamide(CAT: I040475) is a heterocyclic compound featuring a 1,2-oxazole core substituted with a 4-fluorophenyl group and a cyclopentylcarboxamide moiety. This structural arrangement offers a balanced combination of hydrophobic and polar characteristics, making it an attractive scaffold for drug discovery. The fluorinated aromatic ring enhances metabolic stability and potential receptor binding affinity, while the oxazole ring contributes to bioactivity across various therapeutic targets. This compound is suitable for medicinal chemistry applications, including the development of anti-inflammatory, CNS-active, or oncological agents. Supplied in high purity, it supports SAR studies, pharmacological screening, and the design of bioactive heterocycles.
| CAS Number | 912784-67-9 |
| Synonyms | N-cyclopentyl-5-(4-fluorophenyl)-1,2-oxazole-3-carboxamide |
| Molecular Formula | C15H15FN2O2 |
| Purity | ≥95% |
| IUPAC Name | N-cyclopentyl-5-(4-fluorophenyl)-1,2-oxazole-3-carboxamide |
| InChI | InChI=1S/C15H15FN2O2/c16-11-7-5-10(6-8-11)14-9-13(18-20-14)15(19)17-12-3-1-2-4-12/h5-9,12H,1-4H2,(H,17,19) |
| InChIKey | CXPGIBUNOFAQOI-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)NC(=O)C2=NOC(=C2)C3=CC=C(C=C3)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |