For research use only. Not for therapeutic Use.
4-[4-(2-Methoxyphenyl)-6-(trifluoromethyl)pyrimidin-2-yl]morpholine(CAT:I040514) is a heterocyclic compound featuring a trifluoromethyl-substituted pyrimidine core linked to a morpholine ring and a methoxyphenyl group. This structure provides favorable physicochemical properties such as enhanced lipophilicity, metabolic stability, and potential bioactivity. The compound is suitable for use in medicinal chemistry research, particularly in the design and optimization of kinase inhibitors, antiviral agents, or CNS-active molecules. Its combination of electron-withdrawing and electron-donating groups makes it an attractive scaffold for structure–activity relationship (SAR) studies. Supplied in high purity, this compound is ideal for use in lead discovery, chemical biology, and pharmacological profiling.
| CAS Number | 725695-33-0 |
| Synonyms | 4-[4-(2-methoxyphenyl)-6-(trifluoromethyl)pyrimidin-2-yl]morpholine |
| Molecular Formula | C16H16F3N3O2 |
| Purity | ≥95% |
| IUPAC Name | 4-[4-(2-methoxyphenyl)-6-(trifluoromethyl)pyrimidin-2-yl]morpholine |
| InChI | InChI=1S/C16H16F3N3O2/c1-23-13-5-3-2-4-11(13)12-10-14(16(17,18)19)21-15(20-12)22-6-8-24-9-7-22/h2-5,10H,6-9H2,1H3 |
| InChIKey | PFXVPQCNGGTFIM-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC=C1C2=CC(=NC(=N2)N3CCOCC3)C(F)(F)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
