For research use only. Not for therapeutic Use.
1-Phenyl-2-[(4-phenyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]ethanone(CAT: I040466) is a triazole-based thioether compound featuring both aromatic and heteroaromatic systems. Its structure integrates a 1,2,4-triazole core, known for broad-spectrum biological activity, with phenyl and pyridyl substituents that enhance molecular stability and target specificity. The sulfur-linked ethanone group adds further versatility, making it a promising candidate in the development of antimicrobial, antifungal, or anticancer agents. This molecule is ideal for researchers engaged in medicinal chemistry or SAR studies focused on heterocyclic scaffolds with therapeutic potential. Offered in high purity for advanced research in drug design, biochemical assays, and pharmacological profiling.
| CAS Number | 325694-03-9 |
| Synonyms | 1-phenyl-2-[(4-phenyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]ethanone |
| Molecular Formula | C21H16N4OS |
| Purity | ≥95% |
| IUPAC Name | 1-phenyl-2-[(4-phenyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]ethanone |
| InChI | InChI=1S/C21H16N4OS/c26-19(16-7-3-1-4-8-16)15-27-21-24-23-20(17-11-13-22-14-12-17)25(21)18-9-5-2-6-10-18/h1-14H,15H2 |
| InChIKey | GAXBCVHTYQLWPJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)CSC2=NN=C(N2C3=CC=CC=C3)C4=CC=NC=C4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
