For research use only. Not for therapeutic Use.
1-(2,3-Dihydroindol-1-yl)-2-[[5-(2-fluorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]ethanone(CAT: I040473) is a multifunctional heterocyclic compound integrating an indoline ring, a 1,3,4-oxadiazole moiety, and a thioether-linked ethanone bridge. The presence of the fluorinated aryl-oxadiazole contributes to enhanced metabolic stability and potential bioactivity, particularly in antimicrobial, anticancer, or CNS-targeted drug development. The indoline unit supports molecular rigidity and biological relevance, often found in pharmacologically active scaffolds. This compound is ideal for structure-activity relationship (SAR) studies, ligand design, and the exploration of novel therapeutic candidates. Its diverse pharmacophores offer opportunities for targeting enzymes, receptors, or signaling pathways relevant to inflammation, infection, or neurological disorders.
| CAS Number | 571904-77-3 |
| Synonyms | 1-(2,3-dihydroindol-1-yl)-2-[[5-(2-fluorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]ethanone |
| Molecular Formula | C18H14FN3O2S |
| Purity | ≥95% |
| IUPAC Name | 1-(2,3-dihydroindol-1-yl)-2-[[5-(2-fluorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]ethanone |
| InChI | InChI=1S/C18H14FN3O2S/c19-14-7-3-2-6-13(14)17-20-21-18(24-17)25-11-16(23)22-10-9-12-5-1-4-8-15(12)22/h1-8H,9-11H2 |
| InChIKey | BZBQZCZKATXAJK-UHFFFAOYSA-N |
| SMILES | C1CN(C2=CC=CC=C21)C(=O)CSC3=NN=C(O3)C4=CC=CC=C4F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
