For research use only. Not for therapeutic Use.
WAY-309236(CAT: I040621) is a selective inhibitor of sclerostin (SOST), a glycoprotein that negatively regulates the Wnt/β-catenin signaling pathway critical for bone formation. By inhibiting sclerostin activity, WAY-309236 enhances Wnt signaling, leading to increased osteoblast activity and bone mass. It is widely used in preclinical studies focused on osteoporosis and other bone-related disorders, offering a non-antibody approach to stimulate anabolic bone responses. WAY-309236 supports investigations into skeletal remodeling, bone regeneration, and the molecular mechanisms of bone homeostasis. Its efficacy in promoting bone growth makes it a valuable tool in bone biology and drug development research.
| CAS Number | 690697-43-9 |
| Synonyms | 3-[[4-(furan-2-ylmethylamino)quinazolin-2-yl]amino]phenol |
| Molecular Formula | C19H16N4O2 |
| Purity | ≥95% |
| IUPAC Name | 3-[[4-(furan-2-ylmethylamino)quinazolin-2-yl]amino]phenol |
| InChI | InChI=1S/C19H16N4O2/c24-14-6-3-5-13(11-14)21-19-22-17-9-2-1-8-16(17)18(23-19)20-12-15-7-4-10-25-15/h1-11,24H,12H2,(H2,20,21,22,23) |
| InChIKey | PRZVJFFQEBFBKT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NC(=N2)NC3=CC(=CC=C3)O)NCC4=CC=CO4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
