For research use only. Not for therapeutic Use.
1-(4-fluorophenyl)-3-(2-hydroxy-5-methoxyphenyl)propane-1,3-dione(CAT: I040343) is a synthetic diketone compound featuring a substituted phenyl core with fluorine, hydroxyl, and methoxy functional groups. Its structural framework is characteristic of bioactive chalcone or curcumin analogs, known for diverse pharmacological potential, including antioxidant, anti-inflammatory, and anticancer properties. This molecule is a valuable intermediate for medicinal chemistry research, especially in the design of enzyme inhibitors and ligands targeting oxidative stress pathways or signaling proteins. Its dual aromatic system and reactive diketone moiety offer versatile reactivity for further derivatization. Ideal for use in organic synthesis, drug discovery, and structure–activity relationship (SAR) studies.
| CAS Number | 312607-68-4 |
| Synonyms | 1-(4-fluorophenyl)-3-(2-hydroxy-5-methoxyphenyl)propane-1,3-dione |
| Molecular Formula | C16H13FO4 |
| Purity | ≥95% |
| IUPAC Name | 1-(4-fluorophenyl)-3-(2-hydroxy-5-methoxyphenyl)propane-1,3-dione |
| InChI | InChI=1S/C16H13FO4/c1-21-12-6-7-14(18)13(8-12)16(20)9-15(19)10-2-4-11(17)5-3-10/h2-8,18H,9H2,1H3 |
| InChIKey | ABKONMXONQQXKA-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)O)C(=O)CC(=O)C2=CC=C(C=C2)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
