For research use only. Not for therapeutic Use.
4-pyridin-3-yl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline(CAT: I040354) is a fused tricyclic heterocycle featuring a quinoline core bridged to a cyclopentane ring and substituted with a pyridin-3-yl group. This compound exhibits structural rigidity and aromaticity, making it a promising scaffold in medicinal chemistry for the development of kinase inhibitors, CNS-active agents, or antitumor compounds. Its polycyclic framework offers potential for high-affinity binding in hydrophobic pockets of biological targets. Frequently used in structure-activity relationship (SAR) studies and lead optimization, this compound supports drug discovery efforts focused on modulating intracellular signaling pathways and receptor-ligand interactions in various therapeutic areas, including oncology and neuroscience.
| CAS Number | 1005086-69-0 |
| Synonyms | 4-pyridin-3-yl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| Molecular Formula | C17H16N2 |
| Purity | ≥95% |
| IUPAC Name | 4-pyridin-3-yl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| InChI | InChI=1S/C17H16N2/c1-2-9-16-14(6-1)13-7-3-8-15(13)17(19-16)12-5-4-10-18-11-12/h1-7,9-11,13,15,17,19H,8H2 |
| InChIKey | XHRJZONPWDDNHS-UHFFFAOYSA-N |
| SMILES | C1C=CC2C1C(NC3=CC=CC=C23)C4=CN=CC=C4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
