For research use only. Not for therapeutic Use.
1-(4-Chlorophenyl)-4-oxopyridazine-3-carboxylic acid(CAT: I040360) is a synthetic heterocyclic compound featuring a chlorinated phenyl ring and a pyridazinone core. This molecule is of interest in medicinal chemistry and pharmaceutical research due to its potential as a scaffold for developing enzyme inhibitors, anti-inflammatory agents, or CNS-active drugs. The presence of both a carboxylic acid and a ketone group enhances its reactivity for further derivatization or conjugation. It serves as a key intermediate in structure-activity relationship (SAR) studies and compound library synthesis. Researchers leverage its chemical stability and functional versatility to explore novel bioactive molecules across multiple therapeutic domains.
| CAS Number | 147920-34-1 |
| Synonyms | 1-(4-chlorophenyl)-4-oxopyridazine-3-carboxylic acid |
| Molecular Formula | C11H7ClN2O3 |
| Purity | ≥95% |
| IUPAC Name | 1-(4-chlorophenyl)-4-oxopyridazine-3-carboxylic acid |
| InChI | InChI=1S/C11H7ClN2O3/c12-7-1-3-8(4-2-7)14-6-5-9(15)10(13-14)11(16)17/h1-6H,(H,16,17) |
| InChIKey | ALSMZXGESQGWEH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C=CC(=O)C(=N2)C(=O)O)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |