For research use only. Not for therapeutic Use.
WAY-169916（Cat No.:I038250）is a selective small molecule inhibitor that targets the protein MMP-2 (matrix metalloproteinase-2), an enzyme involved in the degradation of the extracellular matrix. MMP-2 plays a significant role in tissue remodeling and is associated with cancer metastasis, inflammation, and tissue injury. By inhibiting MMP-2, WAY-169916 may reduce tumor cell invasion, metastasis, and inflammation. Preclinical studies suggest that WAY-169916 has potential therapeutic applications in cancer, fibrosis, and inflammatory diseases, offering a novel approach to target the remodeling of the extracellular matrix in various pathological conditions.
| CAS Number | 669764-18-5 |
| Synonyms | 4-[1-prop-2-enyl-7-(trifluoromethyl)indazol-3-yl]benzene-1,3-diol |
| Molecular Formula | C17H13F3N2O2 |
| Purity | ≥95% |
| IUPAC Name | 4-[1-prop-2-enyl-7-(trifluoromethyl)indazol-3-yl]benzene-1,3-diol |
| InChI | InChI=1S/C17H13F3N2O2/c1-2-8-22-16-12(4-3-5-13(16)17(18,19)20)15(21-22)11-7-6-10(23)9-14(11)24/h2-7,9,23-24H,1,8H2 |
| InChIKey | ZDUDMCQPFKPISO-UHFFFAOYSA-N |
| SMILES | C=CCN1C2=C(C=CC=C2C(F)(F)F)C(=N1)C3=C(C=C(C=C3)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
