For research use only. Not for therapeutic Use.
VUF-5574（Cat No.:I010397）is a selective agonist for the histamine H4 receptor, a G protein-coupled receptor primarily expressed on immune cells. This compound is instrumental in studying the role of H4 receptors in immune modulation, inflammation, and allergic responses. By selectively activating H4, VUF-5574 helps researchers investigate pathways involved in chemotaxis, cytokine release, and immune cell migration. Its utility extends to preclinical models of asthma, pruritus, and other inflammatory disorders. VUF-5574 serves as a valuable pharmacological tool for elucidating H4 receptor functions and for exploring potential therapeutic targets in immunological research.
| CAS Number | 280570-45-8 |
| Synonyms | 1-(2-methoxyphenyl)-3-(2-pyridin-3-ylquinazolin-4-yl)urea |
| Molecular Formula | C21H17N5O2 |
| Purity | ≥95% |
| IUPAC Name | 1-(2-methoxyphenyl)-3-(2-pyridin-3-ylquinazolin-4-yl)urea |
| InChI | InChI=1S/C21H17N5O2/c1-28-18-11-5-4-10-17(18)24-21(27)26-20-15-8-2-3-9-16(15)23-19(25-20)14-7-6-12-22-13-14/h2-13H,1H3,(H2,23,24,25,26,27) |
| InChIKey | YRAFEJSZTVWUMD-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC=C1NC(=O)NC2=NC(=NC3=CC=CC=C32)C4=CN=CC=C4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
