For research use only. Not for therapeutic Use.
VP-4604（Cat No.:I043594）is a novel small-molecule inhibitor that targets the PTP1B (protein tyrosine phosphatase 1B) enzyme, which plays a crucial role in regulating insulin signaling and metabolic processes. By inhibiting PTP1B, VP-4604 aims to enhance insulin sensitivity, making it a promising candidate for the treatment of type 2 diabetes and obesity. Additionally, its potential to modulate cellular signaling pathways involved in inflammation and metabolism suggests that VP-4604 may offer therapeutic benefits in metabolic diseases. Ongoing research is focused on evaluating its efficacy and safety profile for clinical applications.
| CAS Number | 64268-93-5 |
| Synonyms | 1-(4-nitrophenyl)sulfonylpiperidine |
| Molecular Formula | C11H14N2O4S |
| Purity | ≥95% |
| IUPAC Name | 1-(4-nitrophenyl)sulfonylpiperidine |
| InChI | InChI=1S/C11H14N2O4S/c14-13(15)10-4-6-11(7-5-10)18(16,17)12-8-2-1-3-9-12/h4-7H,1-3,8-9H2 |
| InChIKey | XDPAFNJUKBYWBZ-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)S(=O)(=O)C2=CC=C(C=C2)[N+](=O)[O-] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
