For research use only. Not for therapeutic Use.
Vomifoliol, also known as 7-epi-jasmonic acid, is a naturally occurring compound found in various plants. It plays a role in plant growth regulation and stress responses. This sesquiterpene alcohol is involved in the biosynthesis of plant hormones and can influence processes like seed germination, root growth, and defense mechanisms against environmental stressors and pathogens.
CAS Number | 23526-45-6 |
Molecular Formula | C13H20O3 |
Purity | ≥95% |
Target | Metabolic Enzyme/Protease |
Storage | -20 ℃ |
IUPAC Name | (4S)-4-hydroxy-4-[(E,3R)-3-hydroxybut-1-enyl]-3,5,5-trimethylcyclohex-2-en-1-one |
InChI | InChI=1S/C13H20O3/c1-9-7-11(15)8-12(3,4)13(9,16)6-5-10(2)14/h5-7,10,14,16H,8H2,1-4H3/b6-5+/t10-,13-/m1/s1 |
InChIKey | KPQMCAKZRXOZLB-KOIHBYQTSA-N |
SMILES | CC1=CC(=O)CC(C1(C=CC(C)O)O)(C)C |