For research use only. Not for therapeutic Use.
VK-II-36(Cat No.:I012139)is a selective small molecule inhibitor that targets the protein FAK (focal adhesion kinase), a crucial regulator of cell adhesion, migration, and survival. FAK plays an important role in tumor progression, metastasis, and angiogenesis. By inhibiting FAK, VK-II-36 disrupts key signaling pathways involved in cell motility and the tumor microenvironment, potentially reducing cancer cell invasion and metastasis. Preclinical studies suggest that VK-II-36 may be a promising therapeutic candidate for treating various cancers, including those resistant to traditional therapies, by targeting the cellular mechanisms that drive cancer progression.
| CAS Number | 955371-66-1 |
| Synonyms | 6-(9H-carbazol-4-yloxymethyl)-4-[2-(2-methoxyphenoxy)ethyl]morpholin-3-one |
| Molecular Formula | C26H26N2O5 |
| Purity | ≥95% |
| IUPAC Name | 6-(9H-carbazol-4-yloxymethyl)-4-[2-(2-methoxyphenoxy)ethyl]morpholin-3-one |
| InChI | InChI=1S/C26H26N2O5/c1-30-22-10-4-5-11-23(22)31-14-13-28-15-18(32-17-25(28)29)16-33-24-12-6-9-21-26(24)19-7-2-3-8-20(19)27-21/h2-12,18,27H,13-17H2,1H3 |
| InChIKey | OPUVSUMPCOUABG-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC=C1OCCN2CC(OCC2=O)COC3=CC=CC4=C3C5=CC=CC=C5N4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |