Viomycin(CAT: I010821) is a member of the tuberactinomycin family of antibiotics. It acts by inhibiting group I intron splicing, a process involved in RNA maturation, as well as prokaryotic protein synthesis. Viomycin’s mechanism of action is based on its ability to bind to the ribosome and disrupt the translation process, leading to the inhibition of bacterial protein synthesis. Due to its specific mode of action, viomycin is primarily used in the treatment of tuberculosis caused by drug-resistant strains. Its inhibitory effects on intron splicing also make it a valuable tool in molecular biology research.
| Catalog Number | I010821 |
| CAS Number | 32988-50-4 |
| Synonyms | (S)-3,6-Diamino-N-((3S,9S,12S,15S,Z)3((2R,4S)-6-amino-4-hydroxy-1,2,3,4-tetrahydropyridin-2-yl)-9,12-bis(hydroxymethyl)-2,5,8,11,14-pentaoxo-6-(ureidomethylene)-1,4,7,10,13-pentaazacyclohexadecan-15-yl)hexanamide disulfate |
| Molecular Formula | C25H43N13O10 |
| Purity | 95% |
| Target | DNA Synthesis |
| Solubility | Soluble to 75 mM in water |
| Storage | Store at -20C |
| IUPAC Name | (3S)-3,6-diamino-N-[(3S,6Z,9S,12S,15S)-3-[(4S,6R)-2-amino-4-hydroxy-1,4,5,6-tetrahydropyrimidin-6-yl]-6-[(carbamoylamino)methylidene]-9,12-bis(hydroxymethyl)-2,5,8,11,14-pentaoxo-1,4,7,10,13-pentazacyclohexadec-15-yl]hexanamide |
| InChI | InChI=1S/C25H43N13O10/c26-3-1-2-10(27)4-16(41)32-12-6-30-23(47)18(11-5-17(42)37-24(28)36-11)38-20(44)13(7-31-25(29)48)33-21(45)14(8-39)35-22(46)15(9-40)34-19(12)43/h7,10-12,14-15,17-18,39-40,42H,1-6,8-9,26-27H2,(H,30,47)(H,32,41)(H,33,45)(H,34,43)(H,35,46)(H,38,44)(H3,28,36,37)(H3,29,31,48)/b13-7-/t10-,11+,12-,14-,15-,17-,18-/m0/s1 |
| InChIKey | GXFAIFRPOKBQRV-GHXCTMGLSA-N |
| SMILES | C1C(NC(=NC1O)N)C2C(=O)NCC(C(=O)NC(C(=O)NC(C(=O)NC(=CNC(=O)N)C(=O)N2)CO)CO)NC(=O)CC(CCCN)N |
