For research use only. Not for therapeutic Use.
Violacein is a naturally occurring purple pigment produced by certain bacteria, notably Chromobacterium violaceum and Janthinobacterium lividum. It has attracted significant interest due to its diverse biological activities, including antibacterial, antiviral, antifungal, antiprotozoal, and anticancer properties. Violacein works by inducing oxidative stress and apoptosis in targeted cells, making it a potential candidate for therapeutic applications. Additionally, its vibrant color has led to its exploration as a natural dye in various industries. Research continues to investigate its potential uses in medicine, biotechnology, and environmental applications.
| CAS Number | 548-54-9 |
| Molecular Formula | C20H13N3O3 |
| Purity | ≥95% |
| Target | Metabolic Enzyme/Protease |
| Storage | -20°C |
| IUPAC Name | (3E)-3-[5-(5-hydroxy-1H-indol-3-yl)-2-oxo-1H-pyrrol-3-ylidene]-1H-indol-2-one |
| InChI | InChI=1S/C20H13N3O3/c24-10-5-6-15-12(7-10)14(9-21-15)17-8-13(19(25)23-17)18-11-3-1-2-4-16(11)22-20(18)26/h1-9,21,24H,(H,22,26)(H,23,25)/b18-13+ |
| InChIKey | XAPNKXIRQFHCHN-QGOAFFKASA-N |
| SMILES | C1=CC=C2C(=C1)C(=C3C=C(NC3=O)C4=CNC5=C4C=C(C=C5)O)C(=O)N2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |