For research use only. Not for therapeutic Use.
Vinyl carbamate(Cat No.:R000482) is a chemical compound. It is used in organic synthesis as a versatile building block due to its ability to undergo various reactions, including addition, substitution, and polymerization. Vinyl carbamate is particularly valuable in the synthesis of biologically active compounds and polymers. In medicinal chemistry, it serves as a precursor for the synthesis of carbamate-based drugs with diverse pharmacological activities. Additionally, vinyl carbamate can undergo polymerization to form poly(vinyl carbamate), a biocompatible polymer that has been explored for drug delivery and tissue engineering applications due to its favorable properties such as biodegradability and low toxicity.
CAS Number | 15805-73-9 |
Synonyms | Ethenyl Ester Carbamic Acid; Vinyl Ester Carbamic Acid; NSC 133266; |
Molecular Formula | C3H5NO2 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | ethenyl carbamate |
InChI | InChI=1S/C3H5NO2/c1-2-6-3(4)5/h2H,1H2,(H2,4,5) |
InChIKey | LVLANIHJQRZTPY-UHFFFAOYSA-N |
SMILES | C=COC(=O)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |